About 2-bromodibenzofuran
2-bromodibenzofuran (PubChem CID 6856) has the molecular formula C12H7BrO
and a molecular weight of 247.09 g/mol. Its IUPAC name is 2-bromodibenzofuran.
Molecular Properties
| Compound Name | 2-bromodibenzofuran |
| PubChem CID | 6856 |
| Molecular Formula | C12H7BrO |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | 2-bromodibenzofuran |
| SMILES | Brc1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C12H7BrO/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-7H |
| InChIKey | CRJISNQTZDMKQD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromodibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromodibenzofuran?
The IUPAC name of 2-bromodibenzofuran (CID 6856) is 2-bromodibenzofuran.
What is the SMILES notation for 2-bromodibenzofuran?
The canonical SMILES for 2-bromodibenzofuran is Brc1ccc2oc3ccccc3c2c1.
What is the InChIKey of 2-bromodibenzofuran?
The InChIKey is CRJISNQTZDMKQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrO/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-7H.
What are the key properties of 2-bromodibenzofuran?
2-bromodibenzofuran has a molecular weight of 247.09 g/mol, XLogP of 4.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromodibenzofuran is sourced from PubChem (CID 6856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).