C16H12O8 — CID 68560408
5-(3-carboxyphenyl)cyclohexa-2,5-diene-1,1,3-tricarboxylic acid (PubChem CID 68560408) has the molecular formula C16H12O8 and a molecular weight of 332.26 g/mol. Its IUPAC name is 5-(3-carboxyphenyl)cyclohexa-2,5-diene-1,1,3-tricarboxylic acid.
| Compound Name | 5-(3-carboxyphenyl)cyclohexa-2,5-diene-1,1,3-tricarboxylic acid |
|---|---|
| PubChem CID | 68560408 |
| Molecular Formula | C16H12O8 |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 5-(3-carboxyphenyl)cyclohexa-2,5-diene-1,1,3-tricarboxylic acid |
| SMILES | O=C(O)C1=CC(C(=O)O)(C(=O)O)C=C(c2cccc(C(=O)O)c2)C1 |
| InChI | InChI=1S/C16H12O8/c17-12(18)9-3-1-2-8(4-9)10-5-11(13(19)20)7-16(6-10,14(21)22)15(23)24/h1-4,6-7H,5H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | GWVJTJYNHLOSOE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|