C17H20ClF2N3O2 — CID 68561232
1-(1-chlorocyclopropyl)-6-(2,3-difluorophenoxy)-2-(1,2,4-triazol-1-yl)hexan-1-ol (PubChem CID 68561232) has the molecular formula C17H20ClF2N3O2 and a molecular weight of 371.82 g/mol. Its IUPAC name is 1-(1-chlorocyclopropyl)-6-(2,3-difluorophenoxy)-2-(1,2,4-triazol-1-yl)hexan-1-ol.
| Compound Name | 1-(1-chlorocyclopropyl)-6-(2,3-difluorophenoxy)-2-(1,2,4-triazol-1-yl)hexan-1-ol |
|---|---|
| PubChem CID | 68561232 |
| Molecular Formula | C17H20ClF2N3O2 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 1-(1-chlorocyclopropyl)-6-(2,3-difluorophenoxy)-2-(1,2,4-triazol-1-yl)hexan-1-ol |
| SMILES | OC(C(CCCCOc1cccc(F)c1F)n1cncn1)C1(Cl)CC1 |
| InChI | InChI=1S/C17H20ClF2N3O2/c18-17(7-8-17)16(24)13(23-11-21-10-22-23)5-1-2-9-25-14-6-3-4-12(19)15(14)20/h3-4,6,10-11,13,16,24H,1-2,5,7-9H2 |
| InChIKey | JHGUUKXZYWCJAC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|