About 4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one
4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one (PubChem CID 68561547) has the molecular formula C13H10N4O
and a molecular weight of 238.25 g/mol. Its IUPAC name is 4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one |
| PubChem CID | 68561547 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one |
| SMILES | Nc1ncnc2c1c(=O)ccn2-c1ccccc1 |
| InChI | InChI=1S/C13H10N4O/c14-12-11-10(18)6-7-17(13(11)16-8-15-12)9-4-2-1-3-5-9/h1-8H,(H2,14,15,16) |
| InChIKey | JYARKXVYMJJYHZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one?
The IUPAC name of 4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one (CID 68561547) is 4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one.
What is the SMILES notation for 4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one?
The canonical SMILES for 4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one is Nc1ncnc2c1c(=O)ccn2-c1ccccc1.
What is the InChIKey of 4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one?
The InChIKey is JYARKXVYMJJYHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O/c14-12-11-10(18)6-7-17(13(11)16-8-15-12)9-4-2-1-3-5-9/h1-8H,(H2,14,15,16).
What are the key properties of 4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one?
4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one has a molecular weight of 238.25 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-8-phenylpyrido[2,3-d]pyrimidin-5-one is sourced from PubChem (CID 68561547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).