C12H10N4O — CID 68561888
11-methyl-1,11,12,13-tetrazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8,12-pentaen-15-one (PubChem CID 68561888) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is 11-methyl-1,11,12,13-tetrazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8,12-pentaen-15-one.
| Compound Name | 11-methyl-1,11,12,13-tetrazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8,12-pentaen-15-one |
|---|---|
| PubChem CID | 68561888 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 11-methyl-1,11,12,13-tetrazatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6,8,12-pentaen-15-one |
| SMILES | CN1N=NC2C(=O)n3c(cc4ccccc43)C21 |
| InChI | InChI=1S/C12H10N4O/c1-15-11-9-6-7-4-2-3-5-8(7)16(9)12(17)10(11)13-14-15/h2-6,10-11H,1H3 |
| InChIKey | HQPKRIBMBKRNMN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 49.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |