C29H30Cl2N2O3 — CID 68562427
[7-chloro-1-[2-methyl-4-(2-methylanilino)benzoyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl] 4-chlorobutanoate (PubChem CID 68562427) has the molecular formula C29H30Cl2N2O3 and a molecular weight of 525.48 g/mol. Its IUPAC name is [7-chloro-1-[2-methyl-4-(2-methylanilino)benzoyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl] 4-chlorobutanoate.
| Compound Name | [7-chloro-1-[2-methyl-4-(2-methylanilino)benzoyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl] 4-chlorobutanoate |
|---|---|
| PubChem CID | 68562427 |
| Molecular Formula | C29H30Cl2N2O3 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | [7-chloro-1-[2-methyl-4-(2-methylanilino)benzoyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl] 4-chlorobutanoate |
| SMILES | Cc1ccccc1Nc1ccc(C(=O)N2CCCC(OC(=O)CCCCl)c3cc(Cl)ccc32)c(C)c1 |
| InChI | InChI=1S/C29H30Cl2N2O3/c1-19-7-3-4-8-25(19)32-22-12-13-23(20(2)17-22)29(35)33-16-6-9-27(36-28(34)10-5-15-30)24-18-21(31)11-14-26(24)33/h3-4,7-8,11-14,17-18,27,32H,5-6,9-10,15-16H2,1-2H3 |
| InChIKey | DVBBDQOKWTYBCA-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|