About (3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate
(3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate (PubChem CID 68562613) has the molecular formula C22H23N3O5
and a molecular weight of 409.44 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate.
Molecular Properties
| Compound Name | (3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate |
| PubChem CID | 68562613 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate |
| SMILES | COc1cccc(COC(=O)Nc2ccc(-c3cn[nH]c3)cc2OC2CCOC2)c1 |
| InChI | InChI=1S/C22H23N3O5/c1-27-18-4-2-3-15(9-18)13-29-22(26)25-20-6-5-16(17-11-23-24-12-17)10-21(20)30-19-7-8-28-14-19/h2-6,9-12,19H,7-8,13-14H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | DSMGSHHAYNVTOB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate?
The IUPAC name of (3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate (CID 68562613) is (3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate.
What is the SMILES notation for (3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate?
The canonical SMILES for (3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate is COc1cccc(COC(=O)Nc2ccc(-c3cn[nH]c3)cc2OC2CCOC2)c1.
What is the InChIKey of (3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate?
The InChIKey is DSMGSHHAYNVTOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O5/c1-27-18-4-2-3-15(9-18)13-29-22(26)25-20-6-5-16(17-11-23-24-12-17)10-21(20)30-19-7-8-28-14-19/h2-6,9-12,19H,7-8,13-14H2,1H3,(H,23,24)(H,25,26).
What are the key properties of (3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate?
(3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate has a molecular weight of 409.44 g/mol, XLogP of 4.00, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl N-[2-(oxolan-3-yloxy)-4-(1H-pyrazol-4-yl)phenyl]carbamate is sourced from PubChem (CID 68562613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).