C26H32O5S2 — CID 68563166
2-[3-[(1R,2S,3R)-3-(hydroxymethyl)-2-(3-hydroxy-5-naphthalen-2-ylpent-1-enyl)-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid (PubChem CID 68563166) has the molecular formula C26H32O5S2 and a molecular weight of 488.67 g/mol. Its IUPAC name is 2-[3-[(1R,2S,3R)-3-(hydroxymethyl)-2-(3-hydroxy-5-naphthalen-2-ylpent-1-enyl)-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid.
| Compound Name | 2-[3-[(1R,2S,3R)-3-(hydroxymethyl)-2-(3-hydroxy-5-naphthalen-2-ylpent-1-enyl)-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 68563166 |
| Molecular Formula | C26H32O5S2 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 2-[3-[(1R,2S,3R)-3-(hydroxymethyl)-2-(3-hydroxy-5-naphthalen-2-ylpent-1-enyl)-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCCS[C@H]1C(=O)C[C@@H](CO)[C@@H]1C=CC(O)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H32O5S2/c27-16-21-15-24(29)26(33-13-3-12-32-17-25(30)31)23(21)11-10-22(28)9-7-18-6-8-19-4-1-2-5-20(19)14-18/h1-2,4-6,8,10-11,14,21-23,26-28H,3,7,9,12-13,15-17H2,(H,30,31)/t21-,22?,23-,26+/m0/s1 |
| InChIKey | XPHYVUTUWAEEBG-NCJGEKHMSA-N |
| XLogP | 4.20 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|