C26H27ClN8O3 — CID 68563267
N-[3-[[4-[3-[(4-chlorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1,3,5-triazin-2-yl]amino]-2-methylphenyl]acetamide (PubChem CID 68563267) has the molecular formula C26H27ClN8O3 and a molecular weight of 535.01 g/mol. Its IUPAC name is N-[3-[[4-[3-[(4-chlorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1,3,5-triazin-2-yl]amino]-2-methylphenyl]acetamide.
| Compound Name | N-[3-[[4-[3-[(4-chlorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1,3,5-triazin-2-yl]amino]-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 68563267 |
| Molecular Formula | C26H27ClN8O3 |
| Molecular Weight | 535.01 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | N-[3-[[4-[3-[(4-chlorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1,3,5-triazin-2-yl]amino]-2-methylphenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2ncnc(N3CCC4(CC3)NC(=O)N(Cc3ccc(Cl)cc3)C4=O)n2)c1C |
| InChI | InChI=1S/C26H27ClN8O3/c1-16-20(30-17(2)36)4-3-5-21(16)31-23-28-15-29-24(32-23)34-12-10-26(11-13-34)22(37)35(25(38)33-26)14-18-6-8-19(27)9-7-18/h3-9,15H,10-14H2,1-2H3,(H,30,36)(H,33,38)(H,28,29,31,32) |
| InChIKey | JUQPLFFNSCXSGZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.01 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|