About 5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine
5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 685638) has the molecular formula C7H10FN3S
and a molecular weight of 187.24 g/mol. Its IUPAC name is 5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine |
| PubChem CID | 685638 |
| Molecular Formula | C7H10FN3S |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1ncc(F)c(N(C)C)n1 |
| InChI | InChI=1S/C7H10FN3S/c1-11(2)6-5(8)4-9-7(10-6)12-3/h4H,1-3H3 |
| InChIKey | AXRPQEQGYDHRKG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine?
The IUPAC name of 5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine (CID 685638) is 5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine.
What is the SMILES notation for 5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine?
The canonical SMILES for 5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine is CSc1ncc(F)c(N(C)C)n1.
What is the InChIKey of 5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine?
The InChIKey is AXRPQEQGYDHRKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FN3S/c1-11(2)6-5(8)4-9-7(10-6)12-3/h4H,1-3H3.
What are the key properties of 5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine?
5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine has a molecular weight of 187.24 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N,N-dimethyl-2-methylsulfanylpyrimidin-4-amine is sourced from PubChem (CID 685638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).