About N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide (PubChem CID 685639) has the molecular formula C16H12FN3OS2
and a molecular weight of 345.42 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide.
Molecular Properties
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide |
| PubChem CID | 685639 |
| Molecular Formula | C16H12FN3OS2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide |
| SMILES | O=C(Nc1nnc(SCc2ccccc2)s1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12FN3OS2/c17-13-8-6-12(7-9-13)14(21)18-15-19-20-16(23-15)22-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,18,19,21) |
| InChIKey | MQBBZKCWIDFMIQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|
Analyze N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide?
The IUPAC name of N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide (CID 685639) is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide.
What is the SMILES notation for N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide?
The canonical SMILES for N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide is O=C(Nc1nnc(SCc2ccccc2)s1)c1ccc(F)cc1.
What is the InChIKey of N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide?
The InChIKey is MQBBZKCWIDFMIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FN3OS2/c17-13-8-6-12(7-9-13)14(21)18-15-19-20-16(23-15)22-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,18,19,21).
What are the key properties of N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide?
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide has a molecular weight of 345.42 g/mol, XLogP of 4.22, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-4-fluorobenzamide is sourced from PubChem (CID 685639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).