C24H31N5O4 — CID 68564066
1-(3-aminopropyl)-3-[2-(3-hydroxypropoxy)-4-(1H-pyrazol-4-yl)phenyl]-1-[(3-methoxyphenyl)methyl]urea (PubChem CID 68564066) has the molecular formula C24H31N5O4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 1-(3-aminopropyl)-3-[2-(3-hydroxypropoxy)-4-(1H-pyrazol-4-yl)phenyl]-1-[(3-methoxyphenyl)methyl]urea.
| Compound Name | 1-(3-aminopropyl)-3-[2-(3-hydroxypropoxy)-4-(1H-pyrazol-4-yl)phenyl]-1-[(3-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 68564066 |
| Molecular Formula | C24H31N5O4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 1-(3-aminopropyl)-3-[2-(3-hydroxypropoxy)-4-(1H-pyrazol-4-yl)phenyl]-1-[(3-methoxyphenyl)methyl]urea |
| SMILES | COc1cccc(CN(CCCN)C(=O)Nc2ccc(-c3cn[nH]c3)cc2OCCCO)c1 |
| InChI | InChI=1S/C24H31N5O4/c1-32-21-6-2-5-18(13-21)17-29(10-3-9-25)24(31)28-22-8-7-19(20-15-26-27-16-20)14-23(22)33-12-4-11-30/h2,5-8,13-16,30H,3-4,9-12,17,25H2,1H3,(H,26,27)(H,28,31) |
| InChIKey | SWWNMICAGCLKCB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|