C34H39N9O4 — CID 68564425
2-[(2R)-butan-2-yl]-4-[4-[4-[4-[[(2S,4R)-2-pyridin-4-yl-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 68564425) has the molecular formula C34H39N9O4 and a molecular weight of 637.75 g/mol. Its IUPAC name is 2-[(2R)-butan-2-yl]-4-[4-[4-[4-[[(2S,4R)-2-pyridin-4-yl-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-[(2R)-butan-2-yl]-4-[4-[4-[4-[[(2S,4R)-2-pyridin-4-yl-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 68564425 |
| Molecular Formula | C34H39N9O4 |
| Molecular Weight | 637.75 g/mol |
| Exact Mass | 637.31 |
| IUPAC Name | 2-[(2R)-butan-2-yl]-4-[4-[4-[4-[[(2S,4R)-2-pyridin-4-yl-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CC[C@@H](C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@](Cn6cncn6)(c6ccncc6)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C34H39N9O4/c1-3-26(2)43-33(44)42(25-38-43)30-6-4-28(5-7-30)39-16-18-40(19-17-39)29-8-10-31(11-9-29)45-20-32-21-46-34(47-32,22-41-24-36-23-37-41)27-12-14-35-15-13-27/h4-15,23-26,32H,3,16-22H2,1-2H3/t26-,32-,34-/m1/s1 |
| InChIKey | JVDXZJZYRYQHHV-MPUVIPRMSA-N |
| XLogP | 3.67 |
| TPSA | 117.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.75 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|