C9H10F3N3O4 — CID 68564696
(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-1-yl) 2,2,2-trifluoroacetate (PubChem CID 68564696) has the molecular formula C9H10F3N3O4 and a molecular weight of 281.19 g/mol. Its IUPAC name is (2,4-dioxo-1,3,8-triazaspiro[4.5]decan-1-yl) 2,2,2-trifluoroacetate.
| Compound Name | (2,4-dioxo-1,3,8-triazaspiro[4.5]decan-1-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68564696 |
| Molecular Formula | C9H10F3N3O4 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | (2,4-dioxo-1,3,8-triazaspiro[4.5]decan-1-yl) 2,2,2-trifluoroacetate |
| SMILES | O=C1NC(=O)C2(CCNCC2)N1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H10F3N3O4/c10-9(11,12)6(17)19-15-7(18)14-5(16)8(15)1-3-13-4-2-8/h13H,1-4H2,(H,14,16,18) |
| InChIKey | XEPIZDHSCHKGRV-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|