C17H21N5 — CID 685650
N,N-dimethyl-2-(3,4,6,17-tetrazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),2,4,11,13,15-hexaen-17-yl)ethanamine (PubChem CID 685650) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is N,N-dimethyl-2-(3,4,6,17-tetrazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),2,4,11,13,15-hexaen-17-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-(3,4,6,17-tetrazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),2,4,11,13,15-hexaen-17-yl)ethanamine |
|---|---|
| PubChem CID | 685650 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N,N-dimethyl-2-(3,4,6,17-tetrazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),2,4,11,13,15-hexaen-17-yl)ethanamine |
| SMILES | CN(C)CCn1c2c(c3ccccc31)CCCn1cnnc1-2 |
| InChI | InChI=1S/C17H21N5/c1-20(2)10-11-22-15-8-4-3-6-13(15)14-7-5-9-21-12-18-19-17(21)16(14)22/h3-4,6,8,12H,5,7,9-11H2,1-2H3 |
| InChIKey | XXNVTCPSLHWUJK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|