About [4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate
[4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate (PubChem CID 68565025) has the molecular formula C24H31F2N3O6
and a molecular weight of 495.52 g/mol. Its IUPAC name is [4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate.
Molecular Properties
| Compound Name | [4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate |
| PubChem CID | 68565025 |
| Molecular Formula | C24H31F2N3O6 |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | [4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate |
| SMILES | CCCOc1cc(F)c(Nc2nccc(OC3CCN(OC(=O)OC(C)C)CC3)c2OC)cc1F |
| InChI | InChI=1S/C24H31F2N3O6/c1-5-12-32-21-14-17(25)19(13-18(21)26)28-23-22(31-4)20(6-9-27-23)34-16-7-10-29(11-8-16)35-24(30)33-15(2)3/h6,9,13-16H,5,7-8,10-12H2,1-4H3,(H,27,28) |
| InChIKey | VTVJJRNZQGWOQP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate?
The IUPAC name of [4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate (CID 68565025) is [4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate.
What is the SMILES notation for [4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate?
The canonical SMILES for [4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate is CCCOc1cc(F)c(Nc2nccc(OC3CCN(OC(=O)OC(C)C)CC3)c2OC)cc1F.
What is the InChIKey of [4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate?
The InChIKey is VTVJJRNZQGWOQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31F2N3O6/c1-5-12-32-21-14-17(25)19(13-18(21)26)28-23-22(31-4)20(6-9-27-23)34-16-7-10-29(11-8-16)35-24(30)33-15(2)3/h6,9,13-16H,5,7-8,10-12H2,1-4H3,(H,27,28).
What are the key properties of [4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate?
[4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate has a molecular weight of 495.52 g/mol, XLogP of 5.22, 10 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[2-(2,5-difluoro-4-propoxyanilino)-3-methoxy-4-pyridinyl]oxy]piperidin-1-yl] propan-2-yl carbonate is sourced from PubChem (CID 68565025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).