C25H23ClF3NO6S — CID 68565311
2-[4-chloro-2-[(2,6-difluorophenyl)methyl]-N-(3,4-dimethoxyphenyl)sulfonylanilino]-2-fluorobutanoic acid (PubChem CID 68565311) has the molecular formula C25H23ClF3NO6S and a molecular weight of 557.97 g/mol. Its IUPAC name is 2-[4-chloro-2-[(2,6-difluorophenyl)methyl]-N-(3,4-dimethoxyphenyl)sulfonylanilino]-2-fluorobutanoic acid.
| Compound Name | 2-[4-chloro-2-[(2,6-difluorophenyl)methyl]-N-(3,4-dimethoxyphenyl)sulfonylanilino]-2-fluorobutanoic acid |
|---|---|
| PubChem CID | 68565311 |
| Molecular Formula | C25H23ClF3NO6S |
| Molecular Weight | 557.97 g/mol |
| Exact Mass | 557.09 |
| IUPAC Name | 2-[4-chloro-2-[(2,6-difluorophenyl)methyl]-N-(3,4-dimethoxyphenyl)sulfonylanilino]-2-fluorobutanoic acid |
| SMILES | CCC(F)(C(=O)O)N(c1ccc(Cl)cc1Cc1c(F)cccc1F)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H23ClF3NO6S/c1-4-25(29,24(31)32)30(37(33,34)17-9-11-22(35-2)23(14-17)36-3)21-10-8-16(26)12-15(21)13-18-19(27)6-5-7-20(18)28/h5-12,14H,4,13H2,1-3H3,(H,31,32) |
| InChIKey | PGDWKDAWTODQGT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.97 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|