2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid

C10H9BrN2O3 — CID 68565826

IUPAC2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid
SMILESO=C(O)CN1C(=O)CCc2cc(Br)cnc21
InChIInChI=1S/C10H9BrN2O3/c11-7-3-6-1-2-8(14)13(5-9(15)16)10(6)12-4-7/h3-4H,1-2,5H2,(H,15,16)
InChIKeyAALBOOMTVYUKPW-UHFFFAOYSA-N
MW285.10 g/mol
LogP1.21
Rot. Bonds2

About 2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid

2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid (PubChem CID 68565826) has the molecular formula C10H9BrN2O3 and a molecular weight of 285.10 g/mol. Its IUPAC name is 2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid
PubChem CID68565826
Molecular FormulaC10H9BrN2O3
Molecular Weight285.10 g/mol
Exact Mass283.98
IUPAC Name2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid
SMILESO=C(O)CN1C(=O)CCc2cc(Br)cnc21
InChIInChI=1S/C10H9BrN2O3/c11-7-3-6-1-2-8(14)13(5-9(15)16)10(6)12-4-7/h3-4H,1-2,5H2,(H,15,16)
InChIKeyAALBOOMTVYUKPW-UHFFFAOYSA-N
XLogP1.21
TPSA70.50 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.10
LogP ≤ 51.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid?
The IUPAC name of 2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid (CID 68565826) is 2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid.
What is the SMILES notation for 2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid?
The canonical SMILES for 2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid is O=C(O)CN1C(=O)CCc2cc(Br)cnc21.
What is the InChIKey of 2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid?
The InChIKey is AALBOOMTVYUKPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2O3/c11-7-3-6-1-2-8(14)13(5-9(15)16)10(6)12-4-7/h3-4H,1-2,5H2,(H,15,16).
What are the key properties of 2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid?
2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid has a molecular weight of 285.10 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-2-oxo-3,4-dihydro-1,8-naphthyridin-1-yl)acetic acid is sourced from PubChem (CID 68565826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).