C18H20N6OS — CID 68566675
5-(2-methoxy-6-methylphenyl)-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-2-ylmethyl)-1,2,4-triazin-3-amine (PubChem CID 68566675) has the molecular formula C18H20N6OS and a molecular weight of 368.47 g/mol. Its IUPAC name is 5-(2-methoxy-6-methylphenyl)-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-2-ylmethyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(2-methoxy-6-methylphenyl)-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-2-ylmethyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 68566675 |
| Molecular Formula | C18H20N6OS |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 5-(2-methoxy-6-methylphenyl)-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-2-ylmethyl)-1,2,4-triazin-3-amine |
| SMILES | COc1cccc(C)c1-c1cnnc(NCc2nc3c(s2)CCNC3)n1 |
| InChI | InChI=1S/C18H20N6OS/c1-11-4-3-5-14(25-2)17(11)13-9-21-24-18(23-13)20-10-16-22-12-8-19-7-6-15(12)26-16/h3-5,9,19H,6-8,10H2,1-2H3,(H,20,23,24) |
| InChIKey | KDFSCGXDPYRVCX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |