About [4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol
[4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol (PubChem CID 68567552) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is [4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol |
| PubChem CID | 68567552 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | [4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol |
| SMILES | COc1ccc2nccc(/C=C/C3CCC(CO)CC3)c2n1 |
| InChI | InChI=1S/C18H22N2O2/c1-22-17-9-8-16-18(20-17)15(10-11-19-16)7-6-13-2-4-14(12-21)5-3-13/h6-11,13-14,21H,2-5,12H2,1H3/b7-6+ |
| InChIKey | ZXQSIQKQVDNCPG-VOTSOKGWSA-N |
| XLogP | 3.45 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol?
The IUPAC name of [4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol (CID 68567552) is [4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol.
What is the SMILES notation for [4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol?
The canonical SMILES for [4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol is COc1ccc2nccc(/C=C/C3CCC(CO)CC3)c2n1.
What is the InChIKey of [4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol?
The InChIKey is ZXQSIQKQVDNCPG-VOTSOKGWSA-N. The full InChI is InChI=1S/C18H22N2O2/c1-22-17-9-8-16-18(20-17)15(10-11-19-16)7-6-13-2-4-14(12-21)5-3-13/h6-11,13-14,21H,2-5,12H2,1H3/b7-6+.
What are the key properties of [4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol?
[4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol has a molecular weight of 298.39 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexyl]methanol is sourced from PubChem (CID 68567552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).