C23H28N2O2 — CID 68568181
4-[(E)-2-(6-methoxy-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-3a-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 68568181) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-[(E)-2-(6-methoxy-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-3a-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-(6-methoxy-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-3a-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 68568181 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 4-[(E)-2-(6-methoxy-4,4-dimethyl-1,2-dihydro-[1,3]oxazolo[3,2-a]indol-3a-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | COc1ccc2c(c1)C(C)(C)C1(/C=C/c3ccc(N(C)C)cc3)OCCN21 |
| InChI | InChI=1S/C23H28N2O2/c1-22(2)20-16-19(26-5)10-11-21(20)25-14-15-27-23(22,25)13-12-17-6-8-18(9-7-17)24(3)4/h6-13,16H,14-15H2,1-5H3/b13-12+ |
| InChIKey | JPFRQUYUXWASJB-OUKQBFOZSA-N |
| XLogP | 4.30 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|