About [3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid
[3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid (PubChem CID 68568529) has the molecular formula C18H18ClN3O3S
and a molecular weight of 391.88 g/mol. Its IUPAC name is [3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid.
Molecular Properties
| Compound Name | [3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid |
| PubChem CID | 68568529 |
| Molecular Formula | C18H18ClN3O3S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | [3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid |
| SMILES | CNCCc1c2n(c3cc(Cl)c(NS(=O)(=O)O)cc13)Cc1ccccc1-2 |
| InChI | InChI=1S/C18H18ClN3O3S/c1-20-7-6-13-14-8-16(21-26(23,24)25)15(19)9-17(14)22-10-11-4-2-3-5-12(11)18(13)22/h2-5,8-9,20-21H,6-7,10H2,1H3,(H,23,24,25) |
| InChIKey | GFNBVMUHMHFHTR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid?
The IUPAC name of [3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid (CID 68568529) is [3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid.
What is the SMILES notation for [3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid?
The canonical SMILES for [3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid is CNCCc1c2n(c3cc(Cl)c(NS(=O)(=O)O)cc13)Cc1ccccc1-2.
What is the InChIKey of [3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid?
The InChIKey is GFNBVMUHMHFHTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClN3O3S/c1-20-7-6-13-14-8-16(21-26(23,24)25)15(19)9-17(14)22-10-11-4-2-3-5-12(11)18(13)22/h2-5,8-9,20-21H,6-7,10H2,1H3,(H,23,24,25).
What are the key properties of [3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid?
[3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid has a molecular weight of 391.88 g/mol, XLogP of 3.30, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-11-[2-(methylamino)ethyl]-6H-isoindolo[2,1-a]indol-2-yl]sulfamic acid is sourced from PubChem (CID 68568529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).