About CID 68568728
CID 68568728 (PubChem CID 68568728) has the molecular formula C22H12N2NaO4
and a molecular weight of 391.34 g/mol.
Molecular Properties
| Compound Name | CID 68568728 |
| PubChem CID | 68568728 |
| Molecular Formula | C22H12N2NaO4 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | — |
| SMILES | O=c1oc(-c2ccc(-c3nc4ccccc4c(=O)o3)cc2)nc2ccccc12.[Na] |
| InChI | InChI=1S/C22H12N2O4.Na/c25-21-15-5-1-3-7-17(15)23-19(27-21)13-9-11-14(12-10-13)20-24-18-8-4-2-6-16(18)22(26)28-20;/h1-12H; |
| InChIKey | BVPNDYUPPWMLKV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 68568728 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68568728?
The IUPAC name of CID 68568728 (CID 68568728) is not available.
What is the SMILES notation for CID 68568728?
The canonical SMILES for CID 68568728 is O=c1oc(-c2ccc(-c3nc4ccccc4c(=O)o3)cc2)nc2ccccc12.[Na].
What is the InChIKey of CID 68568728?
The InChIKey is BVPNDYUPPWMLKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12N2O4.Na/c25-21-15-5-1-3-7-17(15)23-19(27-21)13-9-11-14(12-10-13)20-24-18-8-4-2-6-16(18)22(26)28-20;/h1-12H;.
What are the key properties of CID 68568728?
CID 68568728 has a molecular weight of 391.34 g/mol, XLogP of 3.64, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68568728 is sourced from PubChem (CID 68568728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).