C22H21N3 — CID 68569076
3-[(4R,5S)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]-2-ethylpyridine (PubChem CID 68569076) has the molecular formula C22H21N3 and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-[(4R,5S)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]-2-ethylpyridine.
| Compound Name | 3-[(4R,5S)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]-2-ethylpyridine |
|---|---|
| PubChem CID | 68569076 |
| Molecular Formula | C22H21N3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 3-[(4R,5S)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]-2-ethylpyridine |
| SMILES | CCc1ncccc1C1=N[C@H](c2ccccc2)[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C22H21N3/c1-2-19-18(14-9-15-23-19)22-24-20(16-10-5-3-6-11-16)21(25-22)17-12-7-4-8-13-17/h3-15,20-21H,2H2,1H3,(H,24,25)/t20-,21+ |
| InChIKey | SCSONEIGGIMYQD-OYRHEFFESA-N |
| XLogP | 4.48 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |