C19H20BrN3O2S — CID 68569244
(2S,3aS,6aS)-1-[5-(4-bromophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide (PubChem CID 68569244) has the molecular formula C19H20BrN3O2S and a molecular weight of 434.36 g/mol. Its IUPAC name is (2S,3aS,6aS)-1-[5-(4-bromophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide.
| Compound Name | (2S,3aS,6aS)-1-[5-(4-bromophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 68569244 |
| Molecular Formula | C19H20BrN3O2S |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | (2S,3aS,6aS)-1-[5-(4-bromophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxamide |
| SMILES | Cc1nc(C(=O)N2[C@H](C(N)=O)C[C@@H]3CCC[C@@H]32)c(-c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C19H20BrN3O2S/c1-10-22-16(17(26-10)11-5-7-13(20)8-6-11)19(25)23-14-4-2-3-12(14)9-15(23)18(21)24/h5-8,12,14-15H,2-4,9H2,1H3,(H2,21,24)/t12-,14-,15-/m0/s1 |
| InChIKey | XNPRNKLPPCBCRW-QEJZJMRPSA-N |
| XLogP | 3.75 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |