About [(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate
[(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate (PubChem CID 68569530) has the molecular formula C12H14FNO3
and a molecular weight of 239.25 g/mol. Its IUPAC name is [(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate |
| PubChem CID | 68569530 |
| Molecular Formula | C12H14FNO3 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | [(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate |
| SMILES | O=C(O)O[C@H]1C[C@H](Cc2cccc(F)c2)CN1 |
| InChI | InChI=1S/C12H14FNO3/c13-10-3-1-2-8(5-10)4-9-6-11(14-7-9)17-12(15)16/h1-3,5,9,11,14H,4,6-7H2,(H,15,16)/t9-,11-/m0/s1 |
| InChIKey | ZVQGUWUYKKCZIT-ONGXEEELSA-N |
| XLogP | 2.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate?
The IUPAC name of [(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate (CID 68569530) is [(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate.
What is the SMILES notation for [(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate?
The canonical SMILES for [(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate is O=C(O)O[C@H]1C[C@H](Cc2cccc(F)c2)CN1.
What is the InChIKey of [(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate?
The InChIKey is ZVQGUWUYKKCZIT-ONGXEEELSA-N. The full InChI is InChI=1S/C12H14FNO3/c13-10-3-1-2-8(5-10)4-9-6-11(14-7-9)17-12(15)16/h1-3,5,9,11,14H,4,6-7H2,(H,15,16)/t9-,11-/m0/s1.
What are the key properties of [(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate?
[(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate has a molecular weight of 239.25 g/mol, XLogP of 2.00, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-4-[(3-fluorophenyl)methyl]pyrrolidin-2-yl] hydrogen carbonate is sourced from PubChem (CID 68569530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).