About 2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid
2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid (PubChem CID 68569687) has the molecular formula C24H19FN2O3
and a molecular weight of 402.43 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid |
| PubChem CID | 68569687 |
| Molecular Formula | C24H19FN2O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid |
| SMILES | O=C(CC1=NC(c2ccccc2)C(c2ccccc2)N1C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H19FN2O3/c25-19-13-11-16(12-14-19)20(28)15-21-26-22(17-7-3-1-4-8-17)23(27(21)24(29)30)18-9-5-2-6-10-18/h1-14,22-23H,15H2,(H,29,30) |
| InChIKey | FFAKMMUALOXEHH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid?
The IUPAC name of 2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid (CID 68569687) is 2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid.
What is the SMILES notation for 2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid?
The canonical SMILES for 2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid is O=C(CC1=NC(c2ccccc2)C(c2ccccc2)N1C(=O)O)c1ccc(F)cc1.
What is the InChIKey of 2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid?
The InChIKey is FFAKMMUALOXEHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19FN2O3/c25-19-13-11-16(12-14-19)20(28)15-21-26-22(17-7-3-1-4-8-17)23(27(21)24(29)30)18-9-5-2-6-10-18/h1-14,22-23H,15H2,(H,29,30).
What are the key properties of 2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid?
2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid has a molecular weight of 402.43 g/mol, XLogP of 5.27, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-fluorophenyl)-2-oxoethyl]-4,5-diphenyl-4,5-dihydroimidazole-1-carboxylic acid is sourced from PubChem (CID 68569687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).