C25H22F4N2O2 — CID 68569844
(4S,5R)-2-[(5-fluoro-2-methylphenyl)methyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole;2,2,2-trifluoroacetic acid (PubChem CID 68569844) has the molecular formula C25H22F4N2O2 and a molecular weight of 458.46 g/mol. Its IUPAC name is (4S,5R)-2-[(5-fluoro-2-methylphenyl)methyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole;2,2,2-trifluoroacetic acid.
| Compound Name | (4S,5R)-2-[(5-fluoro-2-methylphenyl)methyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68569844 |
| Molecular Formula | C25H22F4N2O2 |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (4S,5R)-2-[(5-fluoro-2-methylphenyl)methyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(F)cc1CC1=N[C@@H](c2ccccc2)[C@@H](c2ccccc2)N1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H21FN2.C2HF3O2/c1-16-12-13-20(24)14-19(16)15-21-25-22(17-8-4-2-5-9-17)23(26-21)18-10-6-3-7-11-18;3-2(4,5)1(6)7/h2-14,22-23H,15H2,1H3,(H,25,26);(H,6,7)/t22-,23+; |
| InChIKey | UUXPISKYBYUXPZ-ZJXXCOCUSA-N |
| XLogP | 5.79 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |