C14H24O2 — CID 68569907
2-(1-ethoxyethenyl)-2,3,3,4-tetramethylcyclohexan-1-one (PubChem CID 68569907) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 2-(1-ethoxyethenyl)-2,3,3,4-tetramethylcyclohexan-1-one.
| Compound Name | 2-(1-ethoxyethenyl)-2,3,3,4-tetramethylcyclohexan-1-one |
|---|---|
| PubChem CID | 68569907 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 2-(1-ethoxyethenyl)-2,3,3,4-tetramethylcyclohexan-1-one |
| SMILES | C=C(OCC)C1(C)C(=O)CCC(C)C1(C)C |
| InChI | InChI=1S/C14H24O2/c1-7-16-11(3)14(6)12(15)9-8-10(2)13(14,4)5/h10H,3,7-9H2,1-2,4-6H3 |
| InChIKey | HJTBHMMJDFSXJX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|