About 2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine
2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine (PubChem CID 68569962) has the molecular formula C19H21BrN2
and a molecular weight of 357.30 g/mol. Its IUPAC name is 2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine.
Molecular Properties
| Compound Name | 2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine |
| PubChem CID | 68569962 |
| Molecular Formula | C19H21BrN2 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine |
| SMILES | CCc1c2n(c3ccc(Br)cc13)Cc1ccccc1-2.CNC |
| InChI | InChI=1S/C17H14BrN.C2H7N/c1-2-13-15-9-12(18)7-8-16(15)19-10-11-5-3-4-6-14(11)17(13)19;1-3-2/h3-9H,2,10H2,1H3;3H,1-2H3 |
| InChIKey | JPZLSRGNDOKFEG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine?
The IUPAC name of 2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine (CID 68569962) is 2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine.
What is the SMILES notation for 2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine?
The canonical SMILES for 2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine is CCc1c2n(c3ccc(Br)cc13)Cc1ccccc1-2.CNC.
What is the InChIKey of 2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine?
The InChIKey is JPZLSRGNDOKFEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrN.C2H7N/c1-2-13-15-9-12(18)7-8-16(15)19-10-11-5-3-4-6-14(11)17(13)19;1-3-2/h3-9H,2,10H2,1H3;3H,1-2H3.
What are the key properties of 2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine?
2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine has a molecular weight of 357.30 g/mol, XLogP of 4.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-11-ethyl-6H-isoindolo[2,1-a]indole;N-methylmethanamine is sourced from PubChem (CID 68569962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).