About 2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine
2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine (PubChem CID 68570051) has the molecular formula C16H19F2NO
and a molecular weight of 279.33 g/mol. Its IUPAC name is 2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine |
| PubChem CID | 68570051 |
| Molecular Formula | C16H19F2NO |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine |
| SMILES | CCC1=CCCC(COCCc2cc(F)ccc2F)=N1 |
| InChI | InChI=1S/C16H19F2NO/c1-2-14-4-3-5-15(19-14)11-20-9-8-12-10-13(17)6-7-16(12)18/h4,6-7,10H,2-3,5,8-9,11H2,1H3 |
| InChIKey | IOAZEKSOGARIIO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine?
The IUPAC name of 2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine (CID 68570051) is 2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine.
What is the SMILES notation for 2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine?
The canonical SMILES for 2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine is CCC1=CCCC(COCCc2cc(F)ccc2F)=N1.
What is the InChIKey of 2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine?
The InChIKey is IOAZEKSOGARIIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2NO/c1-2-14-4-3-5-15(19-14)11-20-9-8-12-10-13(17)6-7-16(12)18/h4,6-7,10H,2-3,5,8-9,11H2,1H3.
What are the key properties of 2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine?
2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine has a molecular weight of 279.33 g/mol, XLogP of 4.05, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,5-difluorophenyl)ethoxymethyl]-6-ethyl-3,4-dihydropyridine is sourced from PubChem (CID 68570051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).