About 5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide
5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 68570369) has the molecular formula C18H12F5N3O
and a molecular weight of 381.30 g/mol. Its IUPAC name is 5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| PubChem CID | 68570369 |
| Molecular Formula | C18H12F5N3O |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)c(C(N)=O)c1-c1ccccc1-c1cccc(F)c1F |
| InChI | InChI=1S/C18H12F5N3O/c1-26-15(13(17(24)27)16(25-26)18(21,22)23)11-6-3-2-5-9(11)10-7-4-8-12(19)14(10)20/h2-8H,1H3,(H2,24,27) |
| InChIKey | GGKWFWOQMBDCAG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide?
The IUPAC name of 5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide (CID 68570369) is 5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
What is the SMILES notation for 5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide?
The canonical SMILES for 5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide is Cn1nc(C(F)(F)F)c(C(N)=O)c1-c1ccccc1-c1cccc(F)c1F.
What is the InChIKey of 5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide?
The InChIKey is GGKWFWOQMBDCAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F5N3O/c1-26-15(13(17(24)27)16(25-26)18(21,22)23)11-6-3-2-5-9(11)10-7-4-8-12(19)14(10)20/h2-8H,1H3,(H2,24,27).
What are the key properties of 5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide?
5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide has a molecular weight of 381.30 g/mol, XLogP of 4.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2,3-difluorophenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide is sourced from PubChem (CID 68570369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).