About 2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide
2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 68570860) has the molecular formula C14H20NO6P
and a molecular weight of 329.29 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide.
Molecular Properties
| Compound Name | 2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide |
| PubChem CID | 68570860 |
| Molecular Formula | C14H20NO6P |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CCCCCC1CCOP(=O)(Oc2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C14H20NO6P/c1-2-3-4-5-13-10-11-19-22(18,20-13)21-14-8-6-12(7-9-14)15(16)17/h6-9,13H,2-5,10-11H2,1H3 |
| InChIKey | KJNSEFQJLYEOJN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide?
The IUPAC name of 2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide (CID 68570860) is 2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide.
What is the SMILES notation for 2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide?
The canonical SMILES for 2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide is CCCCCC1CCOP(=O)(Oc2ccc([N+](=O)[O-])cc2)O1.
What is the InChIKey of 2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide?
The InChIKey is KJNSEFQJLYEOJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20NO6P/c1-2-3-4-5-13-10-11-19-22(18,20-13)21-14-8-6-12(7-9-14)15(16)17/h6-9,13H,2-5,10-11H2,1H3.
What are the key properties of 2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide?
2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide has a molecular weight of 329.29 g/mol, XLogP of 4.47, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenoxy)-4-pentyl-1,3,2λ5-dioxaphosphinane 2-oxide is sourced from PubChem (CID 68570860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).