About 5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran
5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran (PubChem CID 68571106) has the molecular formula C8H10O3
and a molecular weight of 154.17 g/mol. Its IUPAC name is 5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran |
| PubChem CID | 68571106 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran |
| SMILES | C1=C(OC2=CCCO2)OCC1 |
| InChI | InChI=1S/C8H10O3/c1-3-7(9-5-1)11-8-4-2-6-10-8/h3-4H,1-2,5-6H2 |
| InChIKey | ZRNMHYPNKZCWDR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran?
The IUPAC name of 5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran (CID 68571106) is 5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran.
What is the SMILES notation for 5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran?
The canonical SMILES for 5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran is C1=C(OC2=CCCO2)OCC1.
What is the InChIKey of 5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran?
The InChIKey is ZRNMHYPNKZCWDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-3-7(9-5-1)11-8-4-2-6-10-8/h3-4H,1-2,5-6H2.
What are the key properties of 5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran?
5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran has a molecular weight of 154.17 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dihydrofuran-5-yloxy)-2,3-dihydrofuran is sourced from PubChem (CID 68571106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).