C37H33N5O3 — CID 68571235
(4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol;21,22-dihydroporphyrin (PubChem CID 68571235) has the molecular formula C37H33N5O3 and a molecular weight of 595.70 g/mol. Its IUPAC name is (4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol;21,22-dihydroporphyrin.
| Compound Name | (4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol;21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 68571235 |
| Molecular Formula | C37H33N5O3 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | (4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol;21,22-dihydroporphyrin |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C20H14N4.C17H19NO3/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h1-12,21-22H;2-5,10-11,13,16,19-20H,6-8H2,1H3/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;/t;10-,11+,13-,16-,17-/m.0/s1 |
| InChIKey | SLBZQPZAQGNHCB-XMRLEICRSA-N |
| XLogP | 5.85 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|