C13H10F3NO3 — CID 68571272
3-(1H-indol-5-yl)-2-(2,2,2-trifluoroethoxy)prop-2-enoic acid (PubChem CID 68571272) has the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. Its IUPAC name is 3-(1H-indol-5-yl)-2-(2,2,2-trifluoroethoxy)prop-2-enoic acid.
| Compound Name | 3-(1H-indol-5-yl)-2-(2,2,2-trifluoroethoxy)prop-2-enoic acid |
|---|---|
| PubChem CID | 68571272 |
| Molecular Formula | C13H10F3NO3 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-(1H-indol-5-yl)-2-(2,2,2-trifluoroethoxy)prop-2-enoic acid |
| SMILES | O=C(O)C(=Cc1ccc2[nH]ccc2c1)OCC(F)(F)F |
| InChI | InChI=1S/C13H10F3NO3/c14-13(15,16)7-20-11(12(18)19)6-8-1-2-10-9(5-8)3-4-17-10/h1-6,17H,7H2,(H,18,19) |
| InChIKey | CIFHIYVFYAAAPI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|