About 3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one
3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 68571343) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one |
| PubChem CID | 68571343 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | C=CCC1=NNC(=O)CC1 |
| InChI | InChI=1S/C7H10N2O/c1-2-3-6-4-5-7(10)9-8-6/h2H,1,3-5H2,(H,9,10) |
| InChIKey | OZWCULMQEAPUFJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one?
The IUPAC name of 3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one (CID 68571343) is 3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one.
What is the SMILES notation for 3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one?
The canonical SMILES for 3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one is C=CCC1=NNC(=O)CC1.
What is the InChIKey of 3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one?
The InChIKey is OZWCULMQEAPUFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-2-3-6-4-5-7(10)9-8-6/h2H,1,3-5H2,(H,9,10).
What are the key properties of 3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one?
3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one has a molecular weight of 138.17 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enyl-4,5-dihydro-1H-pyridazin-6-one is sourced from PubChem (CID 68571343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).