C37H33F5N4O2 — CID 68571648
3,4-difluoro-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzamide;N-[2-(2-methyl-1H-indol-3-yl)ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 68571648) has the molecular formula C37H33F5N4O2 and a molecular weight of 660.69 g/mol. Its IUPAC name is 3,4-difluoro-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzamide;N-[2-(2-methyl-1H-indol-3-yl)ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | 3,4-difluoro-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzamide;N-[2-(2-methyl-1H-indol-3-yl)ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 68571648 |
| Molecular Formula | C37H33F5N4O2 |
| Molecular Weight | 660.69 g/mol |
| Exact Mass | 660.25 |
| IUPAC Name | 3,4-difluoro-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzamide;N-[2-(2-methyl-1H-indol-3-yl)ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | Cc1[nH]c2ccccc2c1CCNC(=O)c1ccc(C(F)(F)F)cc1.Cc1[nH]c2ccccc2c1CCNC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H17F3N2O.C18H16F2N2O/c1-12-15(16-4-2-3-5-17(16)24-12)10-11-23-18(25)13-6-8-14(9-7-13)19(20,21)22;1-11-13(14-4-2-3-5-17(14)22-11)8-9-21-18(23)12-6-7-15(19)16(20)10-12/h2-9,24H,10-11H2,1H3,(H,23,25);2-7,10,22H,8-9H2,1H3,(H,21,23) |
| InChIKey | BJWSMSSSABKARW-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.69 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|