C18H14N6O — CID 68571996
(3E,5E,7E,13E)-2,11,15,19,21,23-hexazatricyclo[15.6.1.020,24]tetracosa-1,3,5,7,11,13,15,17(24),18,20,22-undecaen-10-one (PubChem CID 68571996) has the molecular formula C18H14N6O and a molecular weight of 330.35 g/mol. Its IUPAC name is (3E,5E,7E,13E)-2,11,15,19,21,23-hexazatricyclo[15.6.1.020,24]tetracosa-1,3,5,7,11,13,15,17(24),18,20,22-undecaen-10-one.
| Compound Name | (3E,5E,7E,13E)-2,11,15,19,21,23-hexazatricyclo[15.6.1.020,24]tetracosa-1,3,5,7,11,13,15,17(24),18,20,22-undecaen-10-one |
|---|---|
| PubChem CID | 68571996 |
| Molecular Formula | C18H14N6O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (3E,5E,7E,13E)-2,11,15,19,21,23-hexazatricyclo[15.6.1.020,24]tetracosa-1,3,5,7,11,13,15,17(24),18,20,22-undecaen-10-one |
| SMILES | O=C1C/C=C/C=C/C=C/N=c2/ncnc3c2=C(C=N3)/C=N\C=C\C=N/1 |
| InChI | InChI=1S/C18H14N6O/c25-15-7-4-2-1-3-5-9-21-17-16-14(11-19-8-6-10-20-15)12-22-18(16)24-13-23-17/h1-6,8-13H,7H2/b3-1+,4-2+,8-6+,9-5+,19-11-,20-10-,21-17+ |
| InChIKey | ATKZOSSHGCXSKL-DNBNRADBSA-N |
| XLogP | 1.17 |
| TPSA | 92.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |