About 2-N,3-N-dipentylpyridine-2,3-diimine
2-N,3-N-dipentylpyridine-2,3-diimine (PubChem CID 68572089) has the molecular formula C15H25N3
and a molecular weight of 247.39 g/mol. Its IUPAC name is 2-N,3-N-dipentylpyridine-2,3-diimine.
Molecular Properties
| Compound Name | 2-N,3-N-dipentylpyridine-2,3-diimine |
| PubChem CID | 68572089 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 2-N,3-N-dipentylpyridine-2,3-diimine |
| SMILES | CCCCC/N=C1\N=CC=C\C1=N/CCCCC |
| InChI | InChI=1S/C15H25N3/c1-3-5-7-11-16-14-10-9-13-18-15(14)17-12-8-6-4-2/h9-10,13H,3-8,11-12H2,1-2H3/b16-14+,17-15- |
| InChIKey | ZQNUGGXFDKWMOH-GGTPAPDOSA-N |
| XLogP | 3.85 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-N,3-N-dipentylpyridine-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,3-N-dipentylpyridine-2,3-diimine?
The IUPAC name of 2-N,3-N-dipentylpyridine-2,3-diimine (CID 68572089) is 2-N,3-N-dipentylpyridine-2,3-diimine.
What is the SMILES notation for 2-N,3-N-dipentylpyridine-2,3-diimine?
The canonical SMILES for 2-N,3-N-dipentylpyridine-2,3-diimine is CCCCC/N=C1\N=CC=C\C1=N/CCCCC.
What is the InChIKey of 2-N,3-N-dipentylpyridine-2,3-diimine?
The InChIKey is ZQNUGGXFDKWMOH-GGTPAPDOSA-N. The full InChI is InChI=1S/C15H25N3/c1-3-5-7-11-16-14-10-9-13-18-15(14)17-12-8-6-4-2/h9-10,13H,3-8,11-12H2,1-2H3/b16-14+,17-15-.
What are the key properties of 2-N,3-N-dipentylpyridine-2,3-diimine?
2-N,3-N-dipentylpyridine-2,3-diimine has a molecular weight of 247.39 g/mol, XLogP of 3.85, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,3-N-dipentylpyridine-2,3-diimine is sourced from PubChem (CID 68572089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).