C26H46O5Si — CID 68572098
dimethyl 2-[2-[1-[(7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]cyclopropyl]ethyl]propanedioate (PubChem CID 68572098) has the molecular formula C26H46O5Si and a molecular weight of 466.74 g/mol. Its IUPAC name is dimethyl 2-[2-[1-[(7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]cyclopropyl]ethyl]propanedioate.
| Compound Name | dimethyl 2-[2-[1-[(7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]cyclopropyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 68572098 |
| Molecular Formula | C26H46O5Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | dimethyl 2-[2-[1-[(7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]cyclopropyl]ethyl]propanedioate |
| SMILES | COC(=O)C(CCC1(C2CCC3C(O[Si](C)(C)C(C)(C)C)CCC[C@@]32C)CC1)C(=O)OC |
| InChI | InChI=1S/C26H46O5Si/c1-24(2,3)32(7,8)31-20-10-9-14-25(4)19(20)11-12-21(25)26(16-17-26)15-13-18(22(27)29-5)23(28)30-6/h18-21H,9-17H2,1-8H3/t19?,20?,21?,25-/m0/s1 |
| InChIKey | JSBKXQNPPTZAKV-CTSGKLTCSA-N |
| XLogP | 6.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|