C26H46O5Si — CID 68572099
4-[1-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]cyclopropyl]-2-ethoxycarbonylbutanoic acid (PubChem CID 68572099) has the molecular formula C26H46O5Si and a molecular weight of 466.74 g/mol. Its IUPAC name is 4-[1-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]cyclopropyl]-2-ethoxycarbonylbutanoic acid.
| Compound Name | 4-[1-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]cyclopropyl]-2-ethoxycarbonylbutanoic acid |
|---|---|
| PubChem CID | 68572099 |
| Molecular Formula | C26H46O5Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 4-[1-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]cyclopropyl]-2-ethoxycarbonylbutanoic acid |
| SMILES | CCOC(=O)C(CCC1(C2CCC3C(O[Si](C)(C)C(C)(C)C)CCCC32C)CC1)C(=O)O |
| InChI | InChI=1S/C26H46O5Si/c1-8-30-23(29)18(22(27)28)13-15-26(16-17-26)21-12-11-19-20(10-9-14-25(19,21)5)31-32(6,7)24(2,3)4/h18-21H,8-17H2,1-7H3,(H,27,28) |
| InChIKey | YROVLOYHUYKWPF-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|