About 1H-pyrrole;1,3-thiazole-2-carboxamide
1H-pyrrole;1,3-thiazole-2-carboxamide (PubChem CID 68572228) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 1H-pyrrole;1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 1H-pyrrole;1,3-thiazole-2-carboxamide |
| PubChem CID | 68572228 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 1H-pyrrole;1,3-thiazole-2-carboxamide |
| SMILES | NC(=O)c1nccs1.c1cc[nH]c1 |
| InChI | InChI=1S/C4H4N2OS.C4H5N/c5-3(7)4-6-1-2-8-4;1-2-4-5-3-1/h1-2H,(H2,5,7);1-5H |
| InChIKey | DFBMVXVINQVSSQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrrole;1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrole;1,3-thiazole-2-carboxamide?
The IUPAC name of 1H-pyrrole;1,3-thiazole-2-carboxamide (CID 68572228) is 1H-pyrrole;1,3-thiazole-2-carboxamide.
What is the SMILES notation for 1H-pyrrole;1,3-thiazole-2-carboxamide?
The canonical SMILES for 1H-pyrrole;1,3-thiazole-2-carboxamide is NC(=O)c1nccs1.c1cc[nH]c1.
What is the InChIKey of 1H-pyrrole;1,3-thiazole-2-carboxamide?
The InChIKey is DFBMVXVINQVSSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2OS.C4H5N/c5-3(7)4-6-1-2-8-4;1-2-4-5-3-1/h1-2H,(H2,5,7);1-5H.
What are the key properties of 1H-pyrrole;1,3-thiazole-2-carboxamide?
1H-pyrrole;1,3-thiazole-2-carboxamide has a molecular weight of 195.25 g/mol, XLogP of 1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrole;1,3-thiazole-2-carboxamide is sourced from PubChem (CID 68572228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).