C35H31ClN6O11 — CID 68572232
[6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 4-methylpiperazine-1-carboxylate;2,3-dibenzoyloxybutanedioic acid (PubChem CID 68572232) has the molecular formula C35H31ClN6O11 and a molecular weight of 747.12 g/mol. Its IUPAC name is [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 4-methylpiperazine-1-carboxylate;2,3-dibenzoyloxybutanedioic acid.
| Compound Name | [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 4-methylpiperazine-1-carboxylate;2,3-dibenzoyloxybutanedioic acid |
|---|---|
| PubChem CID | 68572232 |
| Molecular Formula | C35H31ClN6O11 |
| Molecular Weight | 747.12 g/mol |
| Exact Mass | 746.17 |
| IUPAC Name | [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 4-methylpiperazine-1-carboxylate;2,3-dibenzoyloxybutanedioic acid |
| SMILES | CN1CCN(C(=O)OC2c3nccnc3C(=O)N2c2ccc(Cl)cn2)CC1.O=C(OC(C(=O)O)C(OC(=O)c1ccccc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H14O8.C17H17ClN6O3/c19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12;1-22-6-8-23(9-7-22)17(26)27-16-14-13(19-4-5-20-14)15(25)24(16)12-3-2-11(18)10-21-12/h1-10,13-14H,(H,19,20)(H,21,22);2-5,10,16H,6-9H2,1H3 |
| InChIKey | VWHOMASMFLCMFN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 218.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.12 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|