C24H41F3O3 — CID 68572259
2-[[(7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]methyl]-1,1,1-trifluoro-6,10-dimethylundec-3-ene-2,10-diol (PubChem CID 68572259) has the molecular formula C24H41F3O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-[[(7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]methyl]-1,1,1-trifluoro-6,10-dimethylundec-3-ene-2,10-diol.
| Compound Name | 2-[[(7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]methyl]-1,1,1-trifluoro-6,10-dimethylundec-3-ene-2,10-diol |
|---|---|
| PubChem CID | 68572259 |
| Molecular Formula | C24H41F3O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 2-[[(7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]methyl]-1,1,1-trifluoro-6,10-dimethylundec-3-ene-2,10-diol |
| SMILES | CC(CC=CC(O)(CC1CCC2C(O)CCC[C@]12C)C(F)(F)F)CCCC(C)(C)O |
| InChI | InChI=1S/C24H41F3O3/c1-17(8-5-13-21(2,3)29)9-6-15-23(30,24(25,26)27)16-18-11-12-19-20(28)10-7-14-22(18,19)4/h6,15,17-20,28-30H,5,7-14,16H2,1-4H3/t17?,18?,19?,20?,22-,23?/m1/s1 |
| InChIKey | PEXMBDVIYTZBTQ-GEEIGOFMSA-N |
| XLogP | 5.77 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|