About ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate
ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate (PubChem CID 68572703) has the molecular formula C24H18N2O4
and a molecular weight of 398.42 g/mol. Its IUPAC name is ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate.
Molecular Properties
| Compound Name | ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate |
| PubChem CID | 68572703 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate |
| SMILES | CCOC(=O)Oc1c[nH]c2c(=O)[nH]c3ccc(-c4cccc5ccccc45)cc3c12 |
| InChI | InChI=1S/C24H18N2O4/c1-2-29-24(28)30-20-13-25-22-21(20)18-12-15(10-11-19(18)26-23(22)27)17-9-5-7-14-6-3-4-8-16(14)17/h3-13,25H,2H2,1H3,(H,26,27) |
| InChIKey | GTYROBQOZBWANE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate?
The IUPAC name of ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate (CID 68572703) is ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate.
What is the SMILES notation for ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate?
The canonical SMILES for ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate is CCOC(=O)Oc1c[nH]c2c(=O)[nH]c3ccc(-c4cccc5ccccc45)cc3c12.
What is the InChIKey of ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate?
The InChIKey is GTYROBQOZBWANE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N2O4/c1-2-29-24(28)30-20-13-25-22-21(20)18-12-15(10-11-19(18)26-23(22)27)17-9-5-7-14-6-3-4-8-16(14)17/h3-13,25H,2H2,1H3,(H,26,27).
What are the key properties of ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate?
ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate has a molecular weight of 398.42 g/mol, XLogP of 5.36, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (8-naphthalen-1-yl-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl) carbonate is sourced from PubChem (CID 68572703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).