About 1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone
1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone (PubChem CID 68573027) has the molecular formula C13H20N6O
and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone.
Molecular Properties
| Compound Name | 1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone |
| PubChem CID | 68573027 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone |
| SMILES | CC(=O)N1Cc2nc(N)nc(N3CCN(C)CC3)c2C1 |
| InChI | InChI=1S/C13H20N6O/c1-9(20)19-7-10-11(8-19)15-13(14)16-12(10)18-5-3-17(2)4-6-18/h3-8H2,1-2H3,(H2,14,15,16) |
| InChIKey | YBMNEXSZPZYTTC-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone?
The IUPAC name of 1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone (CID 68573027) is 1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone.
What is the SMILES notation for 1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone?
The canonical SMILES for 1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone is CC(=O)N1Cc2nc(N)nc(N3CCN(C)CC3)c2C1.
What is the InChIKey of 1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone?
The InChIKey is YBMNEXSZPZYTTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N6O/c1-9(20)19-7-10-11(8-19)15-13(14)16-12(10)18-5-3-17(2)4-6-18/h3-8H2,1-2H3,(H2,14,15,16).
What are the key properties of 1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone?
1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone has a molecular weight of 276.34 g/mol, XLogP of -0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-amino-4-(4-methylpiperazin-1-yl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]ethanone is sourced from PubChem (CID 68573027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).