C23H22N4O4 — CID 68573140
4-[2-[6-(2-methoxyethoxy)-3,4-dihydro-2H-chromen-3-yl]-1,3-benzoxazol-6-yl]pyrimidin-2-amine (PubChem CID 68573140) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 4-[2-[6-(2-methoxyethoxy)-3,4-dihydro-2H-chromen-3-yl]-1,3-benzoxazol-6-yl]pyrimidin-2-amine.
| Compound Name | 4-[2-[6-(2-methoxyethoxy)-3,4-dihydro-2H-chromen-3-yl]-1,3-benzoxazol-6-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 68573140 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 4-[2-[6-(2-methoxyethoxy)-3,4-dihydro-2H-chromen-3-yl]-1,3-benzoxazol-6-yl]pyrimidin-2-amine |
| SMILES | COCCOc1ccc2c(c1)CC(c1nc3ccc(-c4ccnc(N)n4)cc3o1)CO2 |
| InChI | InChI=1S/C23H22N4O4/c1-28-8-9-29-17-3-5-20-15(11-17)10-16(13-30-20)22-26-19-4-2-14(12-21(19)31-22)18-6-7-25-23(24)27-18/h2-7,11-12,16H,8-10,13H2,1H3,(H2,24,25,27) |
| InChIKey | MNCRIBMMCOMSEL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 105.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|