C29H32ClN5O4 — CID 68573264
(2R)-2-[(3S,5R)-4-(2-acetamido-2-aminoacetyl)-3-(3-chlorophenyl)-5-methyl-2-oxo-1,4-diazepan-1-yl]-3-naphthalen-1-ylpropanamide (PubChem CID 68573264) has the molecular formula C29H32ClN5O4 and a molecular weight of 550.06 g/mol. Its IUPAC name is (2R)-2-[(3S,5R)-4-(2-acetamido-2-aminoacetyl)-3-(3-chlorophenyl)-5-methyl-2-oxo-1,4-diazepan-1-yl]-3-naphthalen-1-ylpropanamide.
| Compound Name | (2R)-2-[(3S,5R)-4-(2-acetamido-2-aminoacetyl)-3-(3-chlorophenyl)-5-methyl-2-oxo-1,4-diazepan-1-yl]-3-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 68573264 |
| Molecular Formula | C29H32ClN5O4 |
| Molecular Weight | 550.06 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | (2R)-2-[(3S,5R)-4-(2-acetamido-2-aminoacetyl)-3-(3-chlorophenyl)-5-methyl-2-oxo-1,4-diazepan-1-yl]-3-naphthalen-1-ylpropanamide |
| SMILES | CC(=O)NC(N)C(=O)N1[C@H](C)CCN([C@H](Cc2cccc3ccccc23)C(N)=O)C(=O)[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C29H32ClN5O4/c1-17-13-14-34(24(27(32)37)16-20-9-5-8-19-7-3-4-12-23(19)20)28(38)25(21-10-6-11-22(30)15-21)35(17)29(39)26(31)33-18(2)36/h3-12,15,17,24-26H,13-14,16,31H2,1-2H3,(H2,32,37)(H,33,36)/t17-,24-,25+,26?/m1/s1 |
| InChIKey | XSUXBXPHAIHKRR-DZVBPNQTSA-N |
| XLogP | 2.50 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.06 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|