C7H12N6O2 — CID 68573562
3-(1,3,3-triaminoprop-2-enylamino)-1H-pyrimidine-2,4-dione (PubChem CID 68573562) has the molecular formula C7H12N6O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-(1,3,3-triaminoprop-2-enylamino)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-(1,3,3-triaminoprop-2-enylamino)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 68573562 |
| Molecular Formula | C7H12N6O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 3-(1,3,3-triaminoprop-2-enylamino)-1H-pyrimidine-2,4-dione |
| SMILES | NC(N)=CC(N)Nn1c(=O)cc[nH]c1=O |
| InChI | InChI=1S/C7H12N6O2/c8-4(9)3-5(10)12-13-6(14)1-2-11-7(13)15/h1-3,5,12H,8-10H2,(H,11,15) |
| InChIKey | OUQSFTRHVIQTOP-UHFFFAOYSA-N |
| XLogP | -2.88 |
| TPSA | 144.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|